C25H27N3O4S2 — CID 6105712
ethyl 4-[[(5Z)-3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 6105712) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 6105712 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | ethyl 4-[[(5Z)-3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCCCN1C(=O)/C(=C2/Sc3ccc(OC)cc3N2C)S/C1=N\c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H27N3O4S2/c1-5-7-14-28-22(29)21(23-27(3)19-15-18(31-4)12-13-20(19)33-23)34-25(28)26-17-10-8-16(9-11-17)24(30)32-6-2/h8-13,15H,5-7,14H2,1-4H3/b23-21-,26-25- |
| InChIKey | QVIIPQQCRQSNPH-NVHKDRNZSA-N |
| XLogP | 5.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|