C24H27N3O2S2 — CID 3834745
3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylethylimino)-1,3-thiazolidin-4-one (PubChem CID 3834745) has the molecular formula C24H27N3O2S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylethylimino)-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylethylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3834745 |
| Molecular Formula | C24H27N3O2S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-butyl-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylethylimino)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccc(OC)cc3N2C)S/C1=N\CCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O2S2/c1-4-5-15-27-22(28)21(31-24(27)25-14-13-17-9-7-6-8-10-17)23-26(2)19-16-18(29-3)11-12-20(19)30-23/h6-12,16H,4-5,13-15H2,1-3H3/b23-21?,25-24- |
| InChIKey | FDNFEEUTELFBJU-OJQMOGMSSA-N |
| XLogP | 5.38 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|