C22H23N3OS2 — CID 3850313
2-benzylimino-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3850313) has the molecular formula C22H23N3OS2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-benzylimino-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-benzylimino-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3850313 |
| Molecular Formula | C22H23N3OS2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-benzylimino-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccccc3N2C)S/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3OS2/c1-3-4-14-25-20(26)19(21-24(2)17-12-8-9-13-18(17)27-21)28-22(25)23-15-16-10-6-5-7-11-16/h5-13H,3-4,14-15H2,1-2H3/b21-19?,23-22- |
| InChIKey | QGXOAGMWQOLCDK-PLFWMWSJSA-N |
| XLogP | 5.33 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|