C17H18N6OS2 — CID 3091191
(5Z)-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one (PubChem CID 3091191) has the molecular formula C17H18N6OS2 and a molecular weight of 386.51 g/mol. Its IUPAC name is (5Z)-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3091191 |
| Molecular Formula | C17H18N6OS2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (5Z)-3-butyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C2/Sc3ccccc3N2C)SC1=Nc1ncn[nH]1 |
| InChI | InChI=1S/C17H18N6OS2/c1-3-4-9-23-14(24)13(26-17(23)20-16-18-10-19-21-16)15-22(2)11-7-5-6-8-12(11)25-15/h5-8,10H,3-4,9H2,1-2H3,(H,18,19,21)/b15-13-,20-17? |
| InChIKey | IZAQTMXLLUZPLS-OFJKXKPBSA-N |
| XLogP | 3.58 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|