C19H14N6OS2 — CID 3841155
5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one (PubChem CID 3841155) has the molecular formula C19H14N6OS2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3841155 |
| Molecular Formula | C19H14N6OS2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-phenyl-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CN1C(=C2SC(=Nc3ncn[nH]3)N(c3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C19H14N6OS2/c1-24-13-9-5-6-10-14(13)27-17(24)15-16(26)25(12-7-3-2-4-8-12)19(28-15)22-18-20-11-21-23-18/h2-11H,1H3,(H,20,21,23) |
| InChIKey | PVCCQDWJWONJDQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|