C23H16FN3O2S2 — CID 3840978
2-(4-fluorophenyl)imino-3-(4-hydroxyphenyl)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3840978) has the molecular formula C23H16FN3O2S2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imino-3-(4-hydroxyphenyl)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-fluorophenyl)imino-3-(4-hydroxyphenyl)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3840978 |
| Molecular Formula | C23H16FN3O2S2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-(4-fluorophenyl)imino-3-(4-hydroxyphenyl)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CN1C(=C2S/C(=N\c3ccc(F)cc3)N(c3ccc(O)cc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C23H16FN3O2S2/c1-26-18-4-2-3-5-19(18)30-22(26)20-21(29)27(16-10-12-17(28)13-11-16)23(31-20)25-15-8-6-14(24)7-9-15/h2-13,28H,1H3/b22-20?,25-23- |
| InChIKey | RXXRJWWFBRVIFN-JMXNCVAZSA-N |
| XLogP | 5.71 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|