C29H29N3O2S2 — CID 3426307
5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-(1-phenylethylimino)-1,3-thiazolidin-4-one (PubChem CID 3426307) has the molecular formula C29H29N3O2S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-(1-phenylethylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-(1-phenylethylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3426307 |
| Molecular Formula | C29H29N3O2S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-(1-phenylethylimino)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\C(C)c3ccccc3)N(CCc3ccccc3)C2=O)Sc2ccc(OC)cc21 |
| InChI | InChI=1S/C29H29N3O2S2/c1-4-31-24-19-23(34-3)15-16-25(24)35-28(31)26-27(33)32(18-17-21-11-7-5-8-12-21)29(36-26)30-20(2)22-13-9-6-10-14-22/h5-16,19-20H,4,17-18H2,1-3H3/b28-26?,30-29- |
| InChIKey | ZJEFHNIROKCQQY-MRQDHODCSA-N |
| XLogP | 6.73 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|