C28H24ClN3O2S2 — CID 3778173
2-(4-acetylphenyl)imino-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one (PubChem CID 3778173) has the molecular formula C28H24ClN3O2S2 and a molecular weight of 534.11 g/mol. Its IUPAC name is 2-(4-acetylphenyl)imino-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-acetylphenyl)imino-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3778173 |
| Molecular Formula | C28H24ClN3O2S2 |
| Molecular Weight | 534.11 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-(4-acetylphenyl)imino-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\c3ccc(C(C)=O)cc3)N(CCc3ccccc3)C2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C28H24ClN3O2S2/c1-3-31-23-17-21(29)11-14-24(23)35-27(31)25-26(34)32(16-15-19-7-5-4-6-8-19)28(36-25)30-22-12-9-20(10-13-22)18(2)33/h4-14,17H,3,15-16H2,1-2H3/b27-25?,30-28- |
| InChIKey | XXTQIRFCHQLVJS-ATYUZXEASA-N |
| XLogP | 7.15 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.11 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|