C30H29ClN4O2S2 — CID 4617730
5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-morpholin-4-ylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one (PubChem CID 4617730) has the molecular formula C30H29ClN4O2S2 and a molecular weight of 577.18 g/mol. Its IUPAC name is 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-morpholin-4-ylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-morpholin-4-ylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4617730 |
| Molecular Formula | C30H29ClN4O2S2 |
| Molecular Weight | 577.18 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(4-morpholin-4-ylphenyl)imino-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\c3ccc(N4CCOCC4)cc3)N(CCc3ccccc3)C2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C30H29ClN4O2S2/c1-2-34-25-20-22(31)8-13-26(25)38-29(34)27-28(36)35(15-14-21-6-4-3-5-7-21)30(39-27)32-23-9-11-24(12-10-23)33-16-18-37-19-17-33/h3-13,20H,2,14-19H2,1H3/b29-27?,32-30- |
| InChIKey | PEBDLUIDDAQOJS-RQAZMCEBSA-N |
| XLogP | 6.78 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.18 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|