C21H19Cl2N3OS2 — CID 3771847
5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(3-chloro-4-methylphenyl)imino-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 3771847) has the molecular formula C21H19Cl2N3OS2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(3-chloro-4-methylphenyl)imino-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(3-chloro-4-methylphenyl)imino-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3771847 |
| Molecular Formula | C21H19Cl2N3OS2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-(3-chloro-4-methylphenyl)imino-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3ccc(Cl)cc3N2CC)S/C1=N\c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3OS2/c1-4-25-16-10-13(22)7-9-17(16)28-20(25)18-19(27)26(5-2)21(29-18)24-14-8-6-12(3)15(23)11-14/h6-11H,4-5H2,1-3H3/b20-18?,24-21- |
| InChIKey | ODKILQJBRIJDRA-VKNMOEGYSA-N |
| XLogP | 6.69 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|