C26H26N6OS2 — CID 58714597
4-(ethylamino)-3-[[(5Z)-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-4-oxo-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-ylidene]amino]benzonitrile (PubChem CID 58714597) has the molecular formula C26H26N6OS2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-4-oxo-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-ylidene]amino]benzonitrile.
| Compound Name | 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-4-oxo-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
|---|---|
| PubChem CID | 58714597 |
| Molecular Formula | C26H26N6OS2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-4-oxo-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C2\SC3=C(CCCC3)N2C)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C26H26N6OS2/c1-3-29-19-11-10-17(14-27)13-20(19)30-26-32(16-18-7-6-12-28-15-18)24(33)23(35-26)25-31(2)21-8-4-5-9-22(21)34-25/h6-7,10-13,15,29H,3-5,8-9,16H2,1-2H3/b25-23-,30-26- |
| InChIKey | QNOOWAKQQUXKMH-VZUCUVEASA-N |
| XLogP | 5.78 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|