C28H26N6OS2 — CID 142860622
3-[[(5Z)-5-(6-amino-3-ethyl-1,3-benzothiazol-2-ylidene)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile (PubChem CID 142860622) has the molecular formula C28H26N6OS2 and a molecular weight of 526.69 g/mol. Its IUPAC name is 3-[[(5Z)-5-(6-amino-3-ethyl-1,3-benzothiazol-2-ylidene)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile.
| Compound Name | 3-[[(5Z)-5-(6-amino-3-ethyl-1,3-benzothiazol-2-ylidene)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142860622 |
| Molecular Formula | C28H26N6OS2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 3-[[(5Z)-5-(6-amino-3-ethyl-1,3-benzothiazol-2-ylidene)-3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C2\Sc3cc(N)ccc3N2CC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N6OS2/c1-3-31-21-12-10-19(16-29)14-22(21)32-28-34(17-18-8-6-5-7-9-18)26(35)25(37-28)27-33(4-2)23-13-11-20(30)15-24(23)36-27/h5-15,31H,3-4,17,30H2,1-2H3/b27-25-,32-28- |
| InChIKey | MUBMFXCOHUANDK-WVQFJMHCSA-N |
| XLogP | 6.14 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|