C23H23N5S2 — CID 21061513
4-(ethylamino)-3-[[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzonitrile (PubChem CID 21061513) has the molecular formula C23H23N5S2 and a molecular weight of 433.61 g/mol. Its IUPAC name is 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzonitrile.
| Compound Name | 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
|---|---|
| PubChem CID | 21061513 |
| Molecular Formula | C23H23N5S2 |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-(ethylamino)-3-[[(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzonitrile |
| SMILES | C=CCN1C/C(=C2/Sc3ccccc3N2C)S/C1=N\c1cc(C#N)ccc1NCC |
| InChI | InChI=1S/C23H23N5S2/c1-4-12-28-15-21(22-27(3)19-8-6-7-9-20(19)29-22)30-23(28)26-18-13-16(14-24)10-11-17(18)25-5-2/h4,6-11,13,25H,1,5,12,15H2,2-3H3/b22-21-,26-23- |
| InChIKey | MGVSXDNBVMCCRN-ZHPQMHRPSA-N |
| XLogP | 5.62 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|