C30H27N5O4S2 — CID 173221453
methyl 2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-2-[(3-methyl-2H-1,3-benzothiazol-5-yl)oxy]acetate (PubChem CID 173221453) has the molecular formula C30H27N5O4S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is methyl 2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-2-[(3-methyl-2H-1,3-benzothiazol-5-yl)oxy]acetate.
| Compound Name | methyl 2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-2-[(3-methyl-2H-1,3-benzothiazol-5-yl)oxy]acetate |
|---|---|
| PubChem CID | 173221453 |
| Molecular Formula | C30H27N5O4S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | methyl 2-[3-benzyl-2-[5-cyano-2-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-2-[(3-methyl-2H-1,3-benzothiazol-5-yl)oxy]acetate |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\SC(=C(Oc2ccc3c(c2)N(C)CS3)C(=O)OC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H27N5O4S2/c1-4-32-22-12-10-20(16-31)14-23(22)33-30-35(17-19-8-6-5-7-9-19)28(36)27(41-30)26(29(37)38-3)39-21-11-13-25-24(15-21)34(2)18-40-25/h5-15,32H,4,17-18H2,1-3H3/b27-26?,33-30- |
| InChIKey | HREOVXUJXQDVCR-HOTOXJHKSA-N |
| XLogP | 5.72 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|