C30H28N6O3S2 — CID 10175267
[(2E)-2-[3-benzyl-2-[3-cyano-4-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-5-yl] N-ethylcarbamate (PubChem CID 10175267) has the molecular formula C30H28N6O3S2 and a molecular weight of 584.73 g/mol. Its IUPAC name is [(2E)-2-[3-benzyl-2-[3-cyano-4-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-5-yl] N-ethylcarbamate.
| Compound Name | [(2E)-2-[3-benzyl-2-[3-cyano-4-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-5-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 10175267 |
| Molecular Formula | C30H28N6O3S2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | [(2E)-2-[3-benzyl-2-[3-cyano-4-(ethylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]-3-methyl-1,3-benzothiazol-5-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc2c(c1)N(C)/C(=C1\S/C(=N\c3ccc(NCC)c(C#N)c3)N(Cc3ccccc3)C1=O)S2 |
| InChI | InChI=1S/C30H28N6O3S2/c1-4-32-23-13-11-21(15-20(23)17-31)34-29-36(18-19-9-7-6-8-10-19)27(37)26(41-29)28-35(3)24-16-22(12-14-25(24)40-28)39-30(38)33-5-2/h6-16,32H,4-5,18H2,1-3H3,(H,33,38)/b28-26+,34-29- |
| InChIKey | LWXBONXKGIUEDV-WAXBBEFYSA-N |
| XLogP | 6.27 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|