C28H27N5O2S2 — CID 142264294
3-[[(5E)-3-benzyl-5-[1-(4-hydroxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile (PubChem CID 142264294) has the molecular formula C28H27N5O2S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 3-[[(5E)-3-benzyl-5-[1-(4-hydroxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile.
| Compound Name | 3-[[(5E)-3-benzyl-5-[1-(4-hydroxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 142264294 |
| Molecular Formula | C28H27N5O2S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 3-[[(5E)-3-benzyl-5-[1-(4-hydroxy-N-methyl-2-sulfanylanilino)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C(\C)N(C)c2ccc(O)cc2S)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H27N5O2S2/c1-4-30-22-12-10-20(16-29)14-23(22)31-28-33(17-19-8-6-5-7-9-19)27(35)26(37-28)18(2)32(3)24-13-11-21(34)15-25(24)36/h5-15,30,34,36H,4,17H2,1-3H3/b26-18+,31-28- |
| InChIKey | NIBRGJSAIOBTLQ-QADAMMDLSA-N |
| XLogP | 6.12 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|