C30H28N6O3S2 — CID 88915750
3-[[(5E)-3-benzyl-5-[1-[methyl-[(Z)-1-(2-nitrophenyl)-2-sulfanylethenyl]amino]ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile (PubChem CID 88915750) has the molecular formula C30H28N6O3S2 and a molecular weight of 584.73 g/mol. Its IUPAC name is 3-[[(5E)-3-benzyl-5-[1-[methyl-[(Z)-1-(2-nitrophenyl)-2-sulfanylethenyl]amino]ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile.
| Compound Name | 3-[[(5E)-3-benzyl-5-[1-[methyl-[(Z)-1-(2-nitrophenyl)-2-sulfanylethenyl]amino]ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
|---|---|
| PubChem CID | 88915750 |
| Molecular Formula | C30H28N6O3S2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 3-[[(5E)-3-benzyl-5-[1-[methyl-[(Z)-1-(2-nitrophenyl)-2-sulfanylethenyl]amino]ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-(ethylamino)benzonitrile |
| SMILES | CCNc1ccc(C#N)cc1/N=C1\S/C(=C(\C)N(C)/C(=C\S)c2ccccc2[N+](=O)[O-])C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H28N6O3S2/c1-4-32-24-15-14-22(17-31)16-25(24)33-30-35(18-21-10-6-5-7-11-21)29(37)28(41-30)20(2)34(3)27(19-40)23-12-8-9-13-26(23)36(38)39/h5-16,19,32,40H,4,18H2,1-3H3/b27-19-,28-20+,33-30- |
| InChIKey | LUFFHVUXJLMHSK-QDOCEGEFSA-N |
| XLogP | 6.75 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|