C29H32N4O3S2 — CID 142264473
(5E)-3-benzyl-2-imino-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-1,3-thiazolidin-4-one;methyl 4-(ethylamino)benzoate (PubChem CID 142264473) has the molecular formula C29H32N4O3S2 and a molecular weight of 548.73 g/mol. Its IUPAC name is (5E)-3-benzyl-2-imino-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-1,3-thiazolidin-4-one;methyl 4-(ethylamino)benzoate.
| Compound Name | (5E)-3-benzyl-2-imino-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-1,3-thiazolidin-4-one;methyl 4-(ethylamino)benzoate |
|---|---|
| PubChem CID | 142264473 |
| Molecular Formula | C29H32N4O3S2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | (5E)-3-benzyl-2-imino-5-[1-(N-methyl-2-sulfanylanilino)ethylidene]-1,3-thiazolidin-4-one;methyl 4-(ethylamino)benzoate |
| SMILES | CCNc1ccc(C(=O)OC)cc1.[H]/N=C1\S/C(=C(\C)N(C)c2ccccc2S)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H19N3OS2.C10H13NO2/c1-13(21(2)15-10-6-7-11-16(15)24)17-18(23)22(19(20)25-17)12-14-8-4-3-5-9-14;1-3-11-9-6-4-8(5-7-9)10(12)13-2/h3-11,20,24H,12H2,1-2H3;4-7,11H,3H2,1-2H3/b17-13+,20-19-; |
| InChIKey | VORSJSRNPUUIKL-VAMHOLHZSA-N |
| XLogP | 6.26 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|