C22H23N3O2S2 — CID 142264336
(5E)-3-benzyl-2-imino-5-[1-[[(Z)-1-(4-methoxyphenyl)-2-sulfanylethenyl]-methylamino]ethylidene]-1,3-thiazolidin-4-one (PubChem CID 142264336) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is (5E)-3-benzyl-2-imino-5-[1-[[(Z)-1-(4-methoxyphenyl)-2-sulfanylethenyl]-methylamino]ethylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-2-imino-5-[1-[[(Z)-1-(4-methoxyphenyl)-2-sulfanylethenyl]-methylamino]ethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142264336 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (5E)-3-benzyl-2-imino-5-[1-[[(Z)-1-(4-methoxyphenyl)-2-sulfanylethenyl]-methylamino]ethylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C(\C)N(C)/C(=C\S)c2ccc(OC)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2S2/c1-15(24(2)19(14-28)17-9-11-18(27-3)12-10-17)20-21(26)25(22(23)29-20)13-16-7-5-4-6-8-16/h4-12,14,23,28H,13H2,1-3H3/b19-14-,20-15+,23-22- |
| InChIKey | SUINDQKUCLQACK-BPJQEJKBSA-N |
| XLogP | 4.80 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|