C9H19N3O4S2 — CID 173262176
azane;3-ethyl-2H-1,3-benzothiazole;sulfuric acid (PubChem CID 173262176) has the molecular formula C9H19N3O4S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is azane;3-ethyl-2H-1,3-benzothiazole;sulfuric acid.
| Compound Name | azane;3-ethyl-2H-1,3-benzothiazole;sulfuric acid |
|---|---|
| PubChem CID | 173262176 |
| Molecular Formula | C9H19N3O4S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | azane;3-ethyl-2H-1,3-benzothiazole;sulfuric acid |
| SMILES | CCN1CSc2ccccc21.N.N.O=S(=O)(O)O |
| InChI | InChI=1S/C9H11NS.2H3N.H2O4S/c1-2-10-7-11-9-6-4-3-5-8(9)10;;;1-5(2,3)4/h3-6H,2,7H2,1H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | SBPFZZSQNLMPPR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|