C12H17NO2S3 — CID 88660587
bis(ethanethioic S-acid);3-methyl-2H-1,3-benzothiazole (PubChem CID 88660587) has the molecular formula C12H17NO2S3 and a molecular weight of 303.47 g/mol. Its IUPAC name is bis(ethanethioic S-acid);3-methyl-2H-1,3-benzothiazole.
| Compound Name | bis(ethanethioic S-acid);3-methyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 88660587 |
| Molecular Formula | C12H17NO2S3 |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | bis(ethanethioic S-acid);3-methyl-2H-1,3-benzothiazole |
| SMILES | CC(=O)S.CC(=O)S.CN1CSc2ccccc21 |
| InChI | InChI=1S/C8H9NS.2C2H4OS/c1-9-6-10-8-5-3-2-4-7(8)9;2*1-2(3)4/h2-5H,6H2,1H3;2*1H3,(H,3,4) |
| InChIKey | XLZRXHYGYAZTED-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|