C12H14N3OS2- — CID 86735207
2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol thiocyanate (PubChem CID 86735207) has the molecular formula C12H14N3OS2- and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol thiocyanate.
| Compound Name | 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol thiocyanate |
|---|---|
| PubChem CID | 86735207 |
| Molecular Formula | C12H14N3OS2- |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol thiocyanate |
| SMILES | N#C[S-].[H]/N=C1\SCCN1CC(O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2OS.CHNS/c12-11-13(6-7-15-11)8-10(14)9-4-2-1-3-5-9;2-1-3/h1-5,10,12,14H,6-8H2;3H/p-1/b12-11-; |
| InChIKey | IRSCLJADMXHRLY-AFEZEDKISA-M |
| XLogP | 1.72 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|