C17H19N3O — CID 3123763
2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-phenylethanol (PubChem CID 3123763) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-phenylethanol.
| Compound Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 3123763 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)-1-phenylethanol |
| SMILES | [H]/N=c1\n(CC)c2ccccc2n1CC(O)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O/c1-2-19-14-10-6-7-11-15(14)20(17(19)18)12-16(21)13-8-4-3-5-9-13/h3-11,16,18,21H,2,12H2,1H3/b18-17+ |
| InChIKey | UECWBZIWYKDVKW-ISLYRVAYSA-N |
| XLogP | 2.68 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |