C22H19Cl2N3O — CID 1121192
(1R)-2-(3-benzyl-2-iminobenzimidazol-1-yl)-1-(3,4-dichlorophenyl)ethanol (PubChem CID 1121192) has the molecular formula C22H19Cl2N3O and a molecular weight of 412.32 g/mol. Its IUPAC name is (1R)-2-(3-benzyl-2-iminobenzimidazol-1-yl)-1-(3,4-dichlorophenyl)ethanol.
| Compound Name | (1R)-2-(3-benzyl-2-iminobenzimidazol-1-yl)-1-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 1121192 |
| Molecular Formula | C22H19Cl2N3O |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (1R)-2-(3-benzyl-2-iminobenzimidazol-1-yl)-1-(3,4-dichlorophenyl)ethanol |
| SMILES | [H]/N=c1/n(Cc2ccccc2)c2ccccc2n1C[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O/c23-17-11-10-16(12-18(17)24)21(28)14-27-20-9-5-4-8-19(20)26(22(27)25)13-15-6-2-1-3-7-15/h1-12,21,25,28H,13-14H2/b25-22-/t21-/m0/s1 |
| InChIKey | MBKSTSOMOGRYOR-FNLARSECSA-N |
| XLogP | 5.01 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |