C23H22BrN3O — CID 71079180
1-(4-bromophenyl)-2-[2-imino-3-[(4-methylphenyl)methyl]benzimidazol-1-yl]ethanol (PubChem CID 71079180) has the molecular formula C23H22BrN3O and a molecular weight of 436.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[2-imino-3-[(4-methylphenyl)methyl]benzimidazol-1-yl]ethanol.
| Compound Name | 1-(4-bromophenyl)-2-[2-imino-3-[(4-methylphenyl)methyl]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 71079180 |
| Molecular Formula | C23H22BrN3O |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-[2-imino-3-[(4-methylphenyl)methyl]benzimidazol-1-yl]ethanol |
| SMILES | [H]/N=c1/n(Cc2ccc(C)cc2)c2ccccc2n1CC(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrN3O/c1-16-6-8-17(9-7-16)14-26-20-4-2-3-5-21(20)27(23(26)25)15-22(28)18-10-12-19(24)13-11-18/h2-13,22,25,28H,14-15H2,1H3/b25-23- |
| InChIKey | HIGHNZDDKSKJBC-BZZOAKBMSA-N |
| XLogP | 4.78 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |