C12H13N3OS2 — CID 21397217
[3-(2-hydroxy-2-phenylethyl)-2-imino-1,3-thiazolidin-4-yl] thiocyanate (PubChem CID 21397217) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is [3-(2-hydroxy-2-phenylethyl)-2-imino-1,3-thiazolidin-4-yl] thiocyanate.
| Compound Name | [3-(2-hydroxy-2-phenylethyl)-2-imino-1,3-thiazolidin-4-yl] thiocyanate |
|---|---|
| PubChem CID | 21397217 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [3-(2-hydroxy-2-phenylethyl)-2-imino-1,3-thiazolidin-4-yl] thiocyanate |
| SMILES | [H]/N=C1\SCC(SC#N)N1CC(O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3OS2/c13-8-18-11-7-17-12(14)15(11)6-10(16)9-4-2-1-3-5-9/h1-5,10-11,14,16H,6-7H2/b14-12- |
| InChIKey | QIUYAMFGYGVFTH-OWBHPGMISA-N |
| XLogP | 2.24 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|