C11H16N2O5S2 — CID 131888052
2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol;sulfuric acid (PubChem CID 131888052) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol;sulfuric acid.
| Compound Name | 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol;sulfuric acid |
|---|---|
| PubChem CID | 131888052 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-(2-imino-1,3-thiazolidin-3-yl)-1-phenylethanol;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C1\SCCN1CC(O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2OS.H2O4S/c12-11-13(6-7-15-11)8-10(14)9-4-2-1-3-5-9;1-5(2,3)4/h1-5,10,12,14H,6-8H2;(H2,1,2,3,4)/b12-11-; |
| InChIKey | POGCRHQNBPIIHE-AFEZEDKISA-N |
| XLogP | 1.05 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|