C19H24N2O3S — CID 143310566
2-[(2E)-2-[1-(ethylamino)-1-oxopropan-2-ylidene]-3H-1,4-benzothiazin-4-yl]ethyl 2-methylprop-2-enoate (PubChem CID 143310566) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[(2E)-2-[1-(ethylamino)-1-oxopropan-2-ylidene]-3H-1,4-benzothiazin-4-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(2E)-2-[1-(ethylamino)-1-oxopropan-2-ylidene]-3H-1,4-benzothiazin-4-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143310566 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[(2E)-2-[1-(ethylamino)-1-oxopropan-2-ylidene]-3H-1,4-benzothiazin-4-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN1C/C(=C(/C)C(=O)NCC)Sc2ccccc21 |
| InChI | InChI=1S/C19H24N2O3S/c1-5-20-18(22)14(4)17-12-21(10-11-24-19(23)13(2)3)15-8-6-7-9-16(15)25-17/h6-9H,2,5,10-12H2,1,3-4H3,(H,20,22)/b17-14+ |
| InChIKey | PWLFKKGFFWJUSU-SAPNQHFASA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|