C22H25N3O3S2 — CID 89357602
2-[(2E)-2-(1,3-diethyl-4-methylidene-6-oxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 2-methylprop-2-enoate (PubChem CID 89357602) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[(2E)-2-(1,3-diethyl-4-methylidene-6-oxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(2E)-2-(1,3-diethyl-4-methylidene-6-oxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89357602 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[(2E)-2-(1,3-diethyl-4-methylidene-6-oxo-2-sulfanylidene-1,3-diazinan-5-ylidene)-1,3-benzothiazol-3-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN1/C(=c2/c(=C)n(CC)c(=S)n(CC)c2=O)Sc2ccccc21 |
| InChI | InChI=1S/C22H25N3O3S2/c1-6-23-15(5)18(19(26)24(7-2)22(23)29)20-25(12-13-28-21(27)14(3)4)16-10-8-9-11-17(16)30-20/h8-11H,3,5-7,12-13H2,1-2,4H3/b20-18+ |
| InChIKey | ZIWJUHSNAXHFNT-CZIZESTLSA-N |
| XLogP | 2.63 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|