C28H27NO6S — CID 102573179
2-[2-[2-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2,4,6,9(19),10,12(20),17-heptaen-14-yl)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 102573179) has the molecular formula C28H27NO6S and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-[2-[2-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2,4,6,9(19),10,12(20),17-heptaen-14-yl)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2,4,6,9(19),10,12(20),17-heptaen-14-yl)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102573179 |
| Molecular Formula | C28H27NO6S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-[2-[2-(13,15-dioxo-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2,4,6,9(19),10,12(20),17-heptaen-14-yl)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCN1C(=O)c2ccc3c4c2C(C=CC4c2ccccc2S3)C1=O |
| InChI | InChI=1S/C28H27NO6S/c1-17(2)28(32)35-16-15-34-14-13-33-12-11-29-26(30)20-8-7-19-18-5-3-4-6-22(18)36-23-10-9-21(27(29)31)24(20)25(19)23/h3-10,19-20H,1,11-16H2,2H3 |
| InChIKey | SXNDHRWXCRJJNY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|