C14H21NO4 — CID 19797743
2-[2-(2-pyrrol-1-ylethoxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 19797743) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-[2-(2-pyrrol-1-ylethoxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(2-pyrrol-1-ylethoxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19797743 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[2-(2-pyrrol-1-ylethoxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCn1cccc1 |
| InChI | InChI=1S/C14H21NO4/c1-13(2)14(16)19-12-11-18-10-9-17-8-7-15-5-3-4-6-15/h3-6H,1,7-12H2,2H3 |
| InChIKey | JDZPPVZUBKLSNZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|