C25H25NO8 — CID 137492140
2-[6-methoxy-7-[2-(2-methylprop-2-enoyloxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl]ethyl 2-methylprop-2-enoate (PubChem CID 137492140) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is 2-[6-methoxy-7-[2-(2-methylprop-2-enoyloxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[6-methoxy-7-[2-(2-methylprop-2-enoyloxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137492140 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[6-methoxy-7-[2-(2-methylprop-2-enoyloxy)ethoxy]-1,3-dioxobenzo[de]isoquinolin-2-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc2c3c(ccc(OC)c13)C(=O)N(CCOC(=O)C(=C)C)C2=O |
| InChI | InChI=1S/C25H25NO8/c1-14(2)24(29)33-11-10-26-22(27)16-6-8-18(31-5)21-19(9-7-17(20(16)21)23(26)28)32-12-13-34-25(30)15(3)4/h6-9H,1,3,10-13H2,2,4-5H3 |
| InChIKey | IXQLNSPKAJZURR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|