C24H31NO8 — CID 154951951
2-butyl-6,7-bis[2-(2-hydroxyethoxy)ethoxy]benzo[de]isoquinoline-1,3-dione (PubChem CID 154951951) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-butyl-6,7-bis[2-(2-hydroxyethoxy)ethoxy]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-butyl-6,7-bis[2-(2-hydroxyethoxy)ethoxy]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 154951951 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-butyl-6,7-bis[2-(2-hydroxyethoxy)ethoxy]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(OCCOCCO)c3c(OCCOCCO)ccc(c23)C1=O |
| InChI | InChI=1S/C24H31NO8/c1-2-3-8-25-23(28)17-4-6-19(32-15-13-30-11-9-26)22-20(33-16-14-31-12-10-27)7-5-18(21(17)22)24(25)29/h4-7,26-27H,2-3,8-16H2,1H3 |
| InChIKey | SGGNHWDLHUZBAC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|