C16H19N3OS2 — CID 73187613
1,3-diethyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 73187613) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1,3-diethyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1,3-diethyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 73187613 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1,3-diethyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3ccccc3N2CC)N(CC)C1=S |
| InChI | InChI=1S/C16H19N3OS2/c1-4-17-11-9-7-8-10-12(11)22-15(17)13-14(20)19(6-3)16(21)18(13)5-2/h7-10H,4-6H2,1-3H3 |
| InChIKey | VFMOGEYCPLULHW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|