C18H13NO3S — CID 76675199
3-(3-ethyl-1,3-benzothiazol-2-ylidene)chromene-2,4-dione (PubChem CID 76675199) has the molecular formula C18H13NO3S and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-(3-ethyl-1,3-benzothiazol-2-ylidene)chromene-2,4-dione.
| Compound Name | 3-(3-ethyl-1,3-benzothiazol-2-ylidene)chromene-2,4-dione |
|---|---|
| PubChem CID | 76675199 |
| Molecular Formula | C18H13NO3S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-(3-ethyl-1,3-benzothiazol-2-ylidene)chromene-2,4-dione |
| SMILES | CCN1C(=C2C(=O)Oc3ccccc3C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C18H13NO3S/c1-2-19-12-8-4-6-10-14(12)23-17(19)15-16(20)11-7-3-5-9-13(11)22-18(15)21/h3-10H,2H2,1H3 |
| InChIKey | TWSDAZIQPGAJRF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|