C36H30N2O2S2 — CID 53423098
2-[2,5-bis[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]indene-1,3-dione (PubChem CID 53423098) has the molecular formula C36H30N2O2S2 and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-[2,5-bis[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]indene-1,3-dione.
| Compound Name | 2-[2,5-bis[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 53423098 |
| Molecular Formula | C36H30N2O2S2 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 2-[2,5-bis[2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]indene-1,3-dione |
| SMILES | CCN1C(=CC=C2CCC(=CC=C3Sc4ccccc4N3CC)C2=C2C(=O)c3ccccc3C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C36H30N2O2S2/c1-3-37-27-13-7-9-15-29(27)41-31(37)21-19-23-17-18-24(20-22-32-38(4-2)28-14-8-10-16-30(28)42-32)33(23)34-35(39)25-11-5-6-12-26(25)36(34)40/h5-16,19-22H,3-4,17-18H2,1-2H3 |
| InChIKey | IXPGQFPLEGSTJU-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|