C16H22N2O5 — CID 166946412
[6-(3-ethyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate (PubChem CID 166946412) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [6-(3-ethyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate.
| Compound Name | [6-(3-ethyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166946412 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [6-(3-ethyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)n1ccc(=O)n(CC)c1=O |
| InChI | InChI=1S/C16H22N2O5/c1-4-17-14(20)9-10-18(16(17)22)13(19)8-6-5-7-11-23-15(21)12(2)3/h9-10H,2,4-8,11H2,1,3H3 |
| InChIKey | CIXDSWNRFPXKSH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|