C16H22N2O4S — CID 169034606
[6-(2-ethylsulfanyl-4-oxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate (PubChem CID 169034606) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is [6-(2-ethylsulfanyl-4-oxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate.
| Compound Name | [6-(2-ethylsulfanyl-4-oxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169034606 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [6-(2-ethylsulfanyl-4-oxopyrimidin-1-yl)-6-oxohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)n1ccc(=O)nc1SCC |
| InChI | InChI=1S/C16H22N2O4S/c1-4-23-16-17-13(19)9-10-18(16)14(20)8-6-5-7-11-22-15(21)12(2)3/h9-10H,2,4-8,11H2,1,3H3 |
| InChIKey | ZFUODZXNVXRRJA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|