C19H28N2O4S — CID 166950177
6-(1-butanoyl-5-methyl-6-oxopyrimidin-2-yl)sulfanylhexyl 2-methylprop-2-enoate (PubChem CID 166950177) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 6-(1-butanoyl-5-methyl-6-oxopyrimidin-2-yl)sulfanylhexyl 2-methylprop-2-enoate.
| Compound Name | 6-(1-butanoyl-5-methyl-6-oxopyrimidin-2-yl)sulfanylhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166950177 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-(1-butanoyl-5-methyl-6-oxopyrimidin-2-yl)sulfanylhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCSc1ncc(C)c(=O)n1C(=O)CCC |
| InChI | InChI=1S/C19H28N2O4S/c1-5-10-16(22)21-17(23)15(4)13-20-19(21)26-12-9-7-6-8-11-25-18(24)14(2)3/h13H,2,5-12H2,1,3-4H3 |
| InChIKey | WHWCHADKGRQXIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|