C21H33N3O6 — CID 18314417
2-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-methylprop-2-enoate (PubChem CID 18314417) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18314417 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[3,5-bis[2-(2-methylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN1CN(CCOC(=O)C(=C)C)CN(CCOC(=O)C(=C)C)C1 |
| InChI | InChI=1S/C21H33N3O6/c1-16(2)19(25)28-10-7-22-13-23(8-11-29-20(26)17(3)4)15-24(14-22)9-12-30-21(27)18(5)6/h1,3,5,7-15H2,2,4,6H3 |
| InChIKey | ZLBMMLSOPAHLSR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|