C12H12ClNO5S — CID 10734291
ethyl 6-chloro-2-methyl-1,1,3-trioxo-4H-1λ6,2-benzothiazine-4-carboxylate (PubChem CID 10734291) has the molecular formula C12H12ClNO5S and a molecular weight of 317.75 g/mol. Its IUPAC name is ethyl 6-chloro-2-methyl-1,1,3-trioxo-4H-1λ6,2-benzothiazine-4-carboxylate.
| Compound Name | ethyl 6-chloro-2-methyl-1,1,3-trioxo-4H-1λ6,2-benzothiazine-4-carboxylate |
|---|---|
| PubChem CID | 10734291 |
| Molecular Formula | C12H12ClNO5S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | ethyl 6-chloro-2-methyl-1,1,3-trioxo-4H-1λ6,2-benzothiazine-4-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(C)S(=O)(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO5S/c1-3-19-12(16)10-8-6-7(13)4-5-9(8)20(17,18)14(2)11(10)15/h4-6,10H,3H2,1-2H3 |
| InChIKey | NIADBXGVGLGNJI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|