C13H11ClO5S — CID 115072780
ethyl 2-(6-chloro-3-methyl-1,1-dioxo-1-benzothiophen-2-yl)-2-oxoacetate (PubChem CID 115072780) has the molecular formula C13H11ClO5S and a molecular weight of 314.75 g/mol. Its IUPAC name is ethyl 2-(6-chloro-3-methyl-1,1-dioxo-1-benzothiophen-2-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(6-chloro-3-methyl-1,1-dioxo-1-benzothiophen-2-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 115072780 |
| Molecular Formula | C13H11ClO5S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | ethyl 2-(6-chloro-3-methyl-1,1-dioxo-1-benzothiophen-2-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1=C(C)c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C13H11ClO5S/c1-3-19-13(16)11(15)12-7(2)9-5-4-8(14)6-10(9)20(12,17)18/h4-6H,3H2,1-2H3 |
| InChIKey | HLJDWKYEZYVQBP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|