C13H11Cl2O4- — CID 134098750
(E)-1-(2,5-dichlorophenyl)-2-ethoxycarbonyl-3-oxobut-1-en-1-olate (PubChem CID 134098750) has the molecular formula C13H11Cl2O4- and a molecular weight of 302.13 g/mol. Its IUPAC name is (E)-1-(2,5-dichlorophenyl)-2-ethoxycarbonyl-3-oxobut-1-en-1-olate.
| Compound Name | (E)-1-(2,5-dichlorophenyl)-2-ethoxycarbonyl-3-oxobut-1-en-1-olate |
|---|---|
| PubChem CID | 134098750 |
| Molecular Formula | C13H11Cl2O4- |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | (E)-1-(2,5-dichlorophenyl)-2-ethoxycarbonyl-3-oxobut-1-en-1-olate |
| SMILES | CCOC(=O)/C(C(C)=O)=C(/[O-])c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H12Cl2O4/c1-3-19-13(18)11(7(2)16)12(17)9-6-8(14)4-5-10(9)15/h4-6,17H,3H2,1-2H3/p-1/b12-11+ |
| InChIKey | BFPHDVCIYQRLDK-VAWYXSNFSA-M |
| XLogP | 2.22 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|