C12H9Cl2NO3S — CID 169410053
ethyl 2-(2,4-dichlorophenyl)-4-oxo-1,3-thiazole-5-carboxylate (PubChem CID 169410053) has the molecular formula C12H9Cl2NO3S and a molecular weight of 318.18 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)-4-oxo-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)-4-oxo-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169410053 |
| Molecular Formula | C12H9Cl2NO3S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)-4-oxo-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)C1SC(c2ccc(Cl)cc2Cl)=NC1=O |
| InChI | InChI=1S/C12H9Cl2NO3S/c1-2-18-12(17)9-10(16)15-11(19-9)7-4-3-6(13)5-8(7)14/h3-5,9H,2H2,1H3 |
| InChIKey | ICMTZFYNATUMAI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|