C19H15Cl2NO3 — CID 141399849
ethyl 2-(2,4-dichlorophenyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 141399849) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 141399849 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)-6-methyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2Cl)[nH]c2ccc(C)cc2c1=O |
| InChI | InChI=1S/C19H15Cl2NO3/c1-3-25-19(24)16-17(12-6-5-11(20)9-14(12)21)22-15-7-4-10(2)8-13(15)18(16)23/h4-9H,3H2,1-2H3,(H,22,23) |
| InChIKey | RLCFNHQIXMQPBW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |