C19H16ClNO4 — CID 22480990
ethyl 2-(2-chlorophenyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 22480990) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is ethyl 2-(2-chlorophenyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-chlorophenyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 22480990 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | ethyl 2-(2-chlorophenyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2Cl)[nH]c2ccc(OC)cc2c1=O |
| InChI | InChI=1S/C19H16ClNO4/c1-3-25-19(23)16-17(12-6-4-5-7-14(12)20)21-15-9-8-11(24-2)10-13(15)18(16)22/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | UMPJVDBTDCSUEB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |