C19H15Cl2NO4 — CID 46884108
ethyl 2-(3,4-dichlorophenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 46884108) has the molecular formula C19H15Cl2NO4 and a molecular weight of 392.24 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-(3,4-dichlorophenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 46884108 |
| Molecular Formula | C19H15Cl2NO4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | ethyl 2-(3,4-dichlorophenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)[nH]c2cc(OC)ccc2c1=O |
| InChI | InChI=1S/C19H15Cl2NO4/c1-3-26-19(24)16-17(10-4-7-13(20)14(21)8-10)22-15-9-11(25-2)5-6-12(15)18(16)23/h4-9H,3H2,1-2H3,(H,22,23) |
| InChIKey | XVAHBICNDCRGHV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |