C20H17F2NO5 — CID 71455209
ethyl 6-fluoro-2-(3-fluoro-5-methoxyphenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 71455209) has the molecular formula C20H17F2NO5 and a molecular weight of 389.35 g/mol. Its IUPAC name is ethyl 6-fluoro-2-(3-fluoro-5-methoxyphenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-fluoro-2-(3-fluoro-5-methoxyphenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71455209 |
| Molecular Formula | C20H17F2NO5 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | ethyl 6-fluoro-2-(3-fluoro-5-methoxyphenyl)-7-methoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(F)cc(OC)c2)[nH]c2cc(OC)c(F)cc2c1=O |
| InChI | InChI=1S/C20H17F2NO5/c1-4-28-20(25)17-18(10-5-11(21)7-12(6-10)26-2)23-15-9-16(27-3)14(22)8-13(15)19(17)24/h5-9H,4H2,1-3H3,(H,23,24) |
| InChIKey | WDRQAWOIGOJIIL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |