C18H16ClNO2S — CID 71625158
ethyl 3-(4-chlorophenyl)sulfanyl-5-methyl-1H-indole-2-carboxylate (PubChem CID 71625158) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)sulfanyl-5-methyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)sulfanyl-5-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 71625158 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)sulfanyl-5-methyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(C)cc2c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClNO2S/c1-3-22-18(21)16-17(23-13-7-5-12(19)6-8-13)14-10-11(2)4-9-15(14)20-16/h4-10,20H,3H2,1-2H3 |
| InChIKey | QMPJJGKATRZDOQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |