C17H14ClNO2S — CID 10903684
methyl 5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxylate (PubChem CID 10903684) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is methyl 5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxylate.
| Compound Name | methyl 5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10903684 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | methyl 5-chloro-3-(4-methylphenyl)sulfanyl-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(Cl)cc2c1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H14ClNO2S/c1-10-3-6-12(7-4-10)22-16-13-9-11(18)5-8-14(13)19-15(16)17(20)21-2/h3-9,19H,1-2H3 |
| InChIKey | BUSXEMBVPOOJEO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |